C21H21FN6O5 — CID 55969318
tert-butyl N-[2-fluoro-5-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]carbamate (PubChem CID 55969318) has the molecular formula C21H21FN6O5 and a molecular weight of 456.43 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55969318 |
| Molecular Formula | C21H21FN6O5 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]carbamate |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21FN6O5/c1-12-18(25-26-27(12)14-6-5-7-15(11-14)28(31)32)19(29)23-13-8-9-16(22)17(10-13)24-20(30)33-21(2,3)4/h5-11H,1-4H3,(H,23,29)(H,24,30) |
| InChIKey | HWJAFIFSAKVEES-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|