C22H22ClN3O6S2 — CID 4114511
N-(4-chlorophenyl)-2-[1-(4-morpholin-4-ylsulfonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 4114511) has the molecular formula C22H22ClN3O6S2 and a molecular weight of 524.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(4-morpholin-4-ylsulfonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(4-morpholin-4-ylsulfonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4114511 |
| Molecular Formula | C22H22ClN3O6S2 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(4-morpholin-4-ylsulfonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSC1CC(=O)N(c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O6S2/c23-15-1-3-16(4-2-15)24-20(27)14-33-19-13-21(28)26(22(19)29)17-5-7-18(8-6-17)34(30,31)25-9-11-32-12-10-25/h1-8,19H,9-14H2,(H,24,27) |
| InChIKey | RFJXKHUIMUAYGW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|