C19H27N3O6 — CID 8905018
propan-2-yl 4-[[2-[[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylamino]acetyl]amino]benzoate (PubChem CID 8905018) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylamino]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8905018 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | propan-2-yl 4-[[2-[[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylamino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)NC(=O)CN(CC)CC(=O)Nc1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C19H27N3O6/c1-5-22(12-17(24)21-19(26)27-6-2)11-16(23)20-15-9-7-14(8-10-15)18(25)28-13(3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,20,23)(H,21,24,26) |
| InChIKey | CQLOVJXWAHAMPN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |