C23H29N3O5 — CID 9029476
propan-2-yl 4-[[2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetyl]amino]benzoate (PubChem CID 9029476) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9029476 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | propan-2-yl 4-[[2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetyl]amino]benzoate |
| SMILES | CCN(CC(=O)Nc1ccc(C(=O)OC(C)C)cc1)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C23H29N3O5/c1-5-26(15-22(28)25-19-8-6-7-9-20(19)30-4)14-21(27)24-18-12-10-17(11-13-18)23(29)31-16(2)3/h6-13,16H,5,14-15H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | NAHRGOODGUMWPW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |