C19H21ClFN3O3 — CID 9029512
N-(3-chloro-4-fluorophenyl)-2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetamide (PubChem CID 9029512) has the molecular formula C19H21ClFN3O3 and a molecular weight of 393.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 9029512 |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[ethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(F)c(Cl)c1)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C19H21ClFN3O3/c1-3-24(11-18(25)22-13-8-9-15(21)14(20)10-13)12-19(26)23-16-6-4-5-7-17(16)27-2/h4-10H,3,11-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | ASERNRNWSCGTBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |