C20H23NO3S — CID 1179798
propan-2-yl 3-[[2-(4-methylanilino)-2-oxoethyl]sulfanylmethyl]benzoate (PubChem CID 1179798) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(4-methylanilino)-2-oxoethyl]sulfanylmethyl]benzoate.
| Compound Name | propan-2-yl 3-[[2-(4-methylanilino)-2-oxoethyl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 1179798 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | propan-2-yl 3-[[2-(4-methylanilino)-2-oxoethyl]sulfanylmethyl]benzoate |
| SMILES | Cc1ccc(NC(=O)CSCc2cccc(C(=O)OC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-14(2)24-20(23)17-6-4-5-16(11-17)12-25-13-19(22)21-18-9-7-15(3)8-10-18/h4-11,14H,12-13H2,1-3H3,(H,21,22) |
| InChIKey | YHGYYZMWZLWBSP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |