C21H27N3O2S — CID 26825662
1-(2,3-dimethylphenyl)-3-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]thiourea (PubChem CID 26825662) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 26825662 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]thiourea |
| SMILES | Cc1cc(OCC(=O)NNC(=S)Nc2cccc(C)c2C)ccc1C(C)C |
| InChI | InChI=1S/C21H27N3O2S/c1-13(2)18-10-9-17(11-15(18)4)26-12-20(25)23-24-21(27)22-19-8-6-7-14(3)16(19)5/h6-11,13H,12H2,1-5H3,(H,23,25)(H2,22,24,27) |
| InChIKey | ZDXZKRGUPDMJHO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|