C17H18N4O5 — CID 24819119
1-(2,3-dimethylphenyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]urea (PubChem CID 24819119) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]urea |
|---|---|
| PubChem CID | 24819119 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]urea |
| SMILES | Cc1cccc(NC(=O)NNC(=O)COc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C17H18N4O5/c1-11-4-3-5-15(12(11)2)18-17(23)20-19-16(22)10-26-14-8-6-13(7-9-14)21(24)25/h3-9H,10H2,1-2H3,(H,19,22)(H2,18,20,23) |
| InChIKey | YEPRFCYZAGDDIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|