C23H22FN3O5S — CID 58955057
(1R)-5-ethyl-8-fluoro-N-hydroxy-2-[(6-phenoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 58955057) has the molecular formula C23H22FN3O5S and a molecular weight of 471.51 g/mol. Its IUPAC name is (1R)-5-ethyl-8-fluoro-N-hydroxy-2-[(6-phenoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | (1R)-5-ethyl-8-fluoro-N-hydroxy-2-[(6-phenoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 58955057 |
| Molecular Formula | C23H22FN3O5S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (1R)-5-ethyl-8-fluoro-N-hydroxy-2-[(6-phenoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCc1ccc(F)c2c1CCN(S(=O)(=O)c1ccc(Oc3ccccc3)nc1)[C@H]2C(=O)NO |
| InChI | InChI=1S/C23H22FN3O5S/c1-2-15-8-10-19(24)21-18(15)12-13-27(22(21)23(28)26-29)33(30,31)17-9-11-20(25-14-17)32-16-6-4-3-5-7-16/h3-11,14,22,29H,2,12-13H2,1H3,(H,26,28)/t22-/m1/s1 |
| InChIKey | ZYRQPUVSZANJLS-JOCHJYFZSA-N |
| XLogP | 3.37 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|