C16H14ClFN2O4S — CID 87788988
2-[(6-chloro-3-pyridinyl)sulfonyl]-5-fluoro-8-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 87788988) has the molecular formula C16H14ClFN2O4S and a molecular weight of 384.82 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonyl]-5-fluoro-8-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonyl]-5-fluoro-8-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 87788988 |
| Molecular Formula | C16H14ClFN2O4S |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonyl]-5-fluoro-8-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | Cc1ccc(F)c2c1C(C(=O)O)N(S(=O)(=O)c1ccc(Cl)nc1)CC2 |
| InChI | InChI=1S/C16H14ClFN2O4S/c1-9-2-4-12(18)11-6-7-20(15(14(9)11)16(21)22)25(23,24)10-3-5-13(17)19-8-10/h2-5,8,15H,6-7H2,1H3,(H,21,22) |
| InChIKey | SGNIHJAFDIDUKD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|