C23H23N3O5S — CID 143162066
2-[[6-(4-ethylphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 143162066) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[[6-(4-ethylphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | 2-[[6-(4-ethylphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 143162066 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[[6-(4-ethylphenoxy)-3-pyridinyl]sulfonyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCc1ccc(Oc2ccc(S(=O)(=O)N3CCc4ccccc4C3C(=O)NO)cn2)cc1 |
| InChI | InChI=1S/C23H23N3O5S/c1-2-16-7-9-18(10-8-16)31-21-12-11-19(15-24-21)32(29,30)26-14-13-17-5-3-4-6-20(17)22(26)23(27)25-28/h3-12,15,22,28H,2,13-14H2,1H3,(H,25,27) |
| InChIKey | NGPBQBOMFSRAQV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|