C22H19FN2O6S — CID 87788534
[(1S)-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate (PubChem CID 87788534) has the molecular formula C22H19FN2O6S and a molecular weight of 458.47 g/mol. Its IUPAC name is [(1S)-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate.
| Compound Name | [(1S)-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 87788534 |
| Molecular Formula | C22H19FN2O6S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [(1S)-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate |
| SMILES | O=C(NO)O[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H19FN2O6S/c23-16-5-7-17(8-6-16)30-18-9-11-19(12-10-18)32(28,29)25-14-13-15-3-1-2-4-20(15)21(25)31-22(26)24-27/h1-12,21,27H,13-14H2,(H,24,26)/t21-/m0/s1 |
| InChIKey | JCSVNYPQXZMBRR-NRFANRHFSA-N |
| XLogP | 3.98 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|