C20H21FN2O3S — CID 92699904
2-[(1S)-2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-N-prop-2-enylacetamide (PubChem CID 92699904) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[(1S)-2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(1S)-2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 92699904 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[(1S)-2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O3S/c1-2-12-22-20(24)14-19-18-6-4-3-5-15(18)11-13-23(19)27(25,26)17-9-7-16(21)8-10-17/h2-10,19H,1,11-14H2,(H,22,24)/t19-/m0/s1 |
| InChIKey | LFBKBMCWVZNFHH-IBGZPJMESA-N |
| XLogP | 2.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|