C17H16NO4S- — CID 6930319
2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 6930319) has the molecular formula C17H16NO4S- and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 6930319 |
| Molecular Formula | C17H16NO4S- |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[(1S)-2-(benzenesulfonyl)-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | O=C([O-])C[C@H]1c2ccccc2CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO4S/c19-17(20)12-16-15-9-5-4-6-13(15)10-11-18(16)23(21,22)14-7-2-1-3-8-14/h1-9,16H,10-12H2,(H,19,20)/p-1/t16-/m0/s1 |
| InChIKey | ICIVFNJHEOEAAI-INIZCTEOSA-M |
| XLogP | 1.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |