C25H25FN2O8S — CID 87188043
[2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate (PubChem CID 87188043) has the molecular formula C25H25FN2O8S and a molecular weight of 532.55 g/mol. Its IUPAC name is [2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate.
| Compound Name | [2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 87188043 |
| Molecular Formula | C25H25FN2O8S |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | [2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-methoxyethoxy)-3,4-dihydro-1H-isoquinolin-1-yl] N-hydroxycarbamate |
| SMILES | COCCOc1ccc2c(c1)CCN(S(=O)(=O)c1ccc(Oc3ccc(F)cc3)cc1)C2OC(=O)NO |
| InChI | InChI=1S/C25H25FN2O8S/c1-33-14-15-34-21-8-11-23-17(16-21)12-13-28(24(23)36-25(29)27-30)37(31,32)22-9-6-20(7-10-22)35-19-4-2-18(26)3-5-19/h2-11,16,24,30H,12-15H2,1H3,(H,27,29) |
| InChIKey | NNKFOXPVCBRPDP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|