C27H25N3O6S — CID 87834818
but-2-ynyl-[4-[4-[[(1S)-1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamic acid (PubChem CID 87834818) has the molecular formula C27H25N3O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is but-2-ynyl-[4-[4-[[(1S)-1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamic acid.
| Compound Name | but-2-ynyl-[4-[4-[[(1S)-1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87834818 |
| Molecular Formula | C27H25N3O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | but-2-ynyl-[4-[4-[[(1S)-1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamic acid |
| SMILES | CC#CCN(C(=O)O)c1ccc(-c2ccc(S(=O)(=O)N3CCc4ccccc4[C@H]3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O6S/c1-2-3-17-29(27(32)33)22-12-8-19(9-13-22)20-10-14-23(15-11-20)37(35,36)30-18-16-21-6-4-5-7-24(21)25(30)26(31)28-34/h4-15,25,34H,16-18H2,1H3,(H,28,31)(H,32,33)/t25-/m0/s1 |
| InChIKey | ZWFMAZJOAYYJHJ-VWLOTQADSA-N |
| XLogP | 3.65 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|