C24H21N3O4S — CID 25118880
N-hydroxy-2-(4-phenylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxamide (PubChem CID 25118880) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-hydroxy-2-(4-phenylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxamide.
| Compound Name | N-hydroxy-2-(4-phenylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 25118880 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-hydroxy-2-(4-phenylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxamide |
| SMILES | O=C(NO)C1c2[nH]c3ccccc3c2CCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c28-24(26-29)23-22-20(19-8-4-5-9-21(19)25-22)14-15-27(23)32(30,31)18-12-10-17(11-13-18)16-6-2-1-3-7-16/h1-13,23,25,29H,14-15H2,(H,26,28) |
| InChIKey | JQONVEUTRDXNSQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|