C25H25N3O6S — CID 152761174
(2R,4R)-4-benzamido-N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonylpiperidine-2-carboxamide (PubChem CID 152761174) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is (2R,4R)-4-benzamido-N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonylpiperidine-2-carboxamide.
| Compound Name | (2R,4R)-4-benzamido-N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 152761174 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (2R,4R)-4-benzamido-N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonylpiperidine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(S(=O)(=O)c2ccc(-c3ccc(O)cc3)cc2)[C@@H](C(=O)NO)C1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O6S/c29-21-10-6-17(7-11-21)18-8-12-22(13-9-18)35(33,34)28-15-14-20(16-23(28)25(31)27-32)26-24(30)19-4-2-1-3-5-19/h1-13,20,23,29,32H,14-16H2,(H,26,30)(H,27,31)/t20-,23-/m1/s1 |
| InChIKey | IYTAYSGCRMVPHB-NFBKMPQASA-N |
| XLogP | 2.52 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|