C19H20N2O6S — CID 22644797
4-benzoyl-1-(4-hydroxyphenyl)sulfonyl-1,4-diazepane-2-carboxylic acid (PubChem CID 22644797) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-benzoyl-1-(4-hydroxyphenyl)sulfonyl-1,4-diazepane-2-carboxylic acid.
| Compound Name | 4-benzoyl-1-(4-hydroxyphenyl)sulfonyl-1,4-diazepane-2-carboxylic acid |
|---|---|
| PubChem CID | 22644797 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-benzoyl-1-(4-hydroxyphenyl)sulfonyl-1,4-diazepane-2-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)c2ccccc2)CCCN1S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20N2O6S/c22-15-7-9-16(10-8-15)28(26,27)21-12-4-11-20(13-17(21)19(24)25)18(23)14-5-2-1-3-6-14/h1-3,5-10,17,22H,4,11-13H2,(H,24,25) |
| InChIKey | UJJBDVDIOZUYAZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |