C22H24N2O4S — CID 25118876
2-(4-tert-butylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid (PubChem CID 25118876) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid.
| Compound Name | 2-(4-tert-butylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 25118876 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCc3c([nH]c4ccccc34)C2C(=O)O)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-22(2,3)14-8-10-15(11-9-14)29(27,28)24-13-12-17-16-6-4-5-7-18(16)23-19(17)20(24)21(25)26/h4-11,20,23H,12-13H2,1-3H3,(H,25,26) |
| InChIKey | OUMRIZISRJBXKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|