C26H27N3O6S — CID 90726502
propan-2-yl N-[4-[4-[[1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamate (PubChem CID 90726502) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is propan-2-yl N-[4-[4-[[1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[4-[[1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 90726502 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | propan-2-yl N-[4-[4-[[1-(hydroxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]phenyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1ccc(-c2ccc(S(=O)(=O)N3CCc4ccccc4C3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O6S/c1-17(2)35-26(31)27-21-11-7-18(8-12-21)19-9-13-22(14-10-19)36(33,34)29-16-15-20-5-3-4-6-23(20)24(29)25(30)28-32/h3-14,17,24,32H,15-16H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | GJRARBHGFVWAER-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|