C27H24Cl2N4O7S — CID 10031802
2-(2,5-dichlorophenyl)-N-hydroxy-5-[4-(3-methoxy-5-methylphenoxy)phenyl]sulfonyl-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 10031802) has the molecular formula C27H24Cl2N4O7S and a molecular weight of 619.48 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-N-hydroxy-5-[4-(3-methoxy-5-methylphenoxy)phenyl]sulfonyl-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | 2-(2,5-dichlorophenyl)-N-hydroxy-5-[4-(3-methoxy-5-methylphenoxy)phenyl]sulfonyl-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10031802 |
| Molecular Formula | C27H24Cl2N4O7S |
| Molecular Weight | 619.48 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-N-hydroxy-5-[4-(3-methoxy-5-methylphenoxy)phenyl]sulfonyl-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | COc1cc(C)cc(Oc2ccc(S(=O)(=O)N3CCc4[nH]n(-c5cc(Cl)ccc5Cl)c(=O)c4C3C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C27H24Cl2N4O7S/c1-15-11-18(39-2)14-19(12-15)40-17-4-6-20(7-5-17)41(37,38)32-10-9-22-24(25(32)26(34)31-36)27(35)33(30-22)23-13-16(28)3-8-21(23)29/h3-8,11-14,25,30,36H,9-10H2,1-2H3,(H,31,34) |
| InChIKey | ROEBSAPFHRJBBH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|