C28H27ClN4O6S — CID 139996632
2-(3-chlorophenyl)-5-[4-[(2,5-dimethylphenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 139996632) has the molecular formula C28H27ClN4O6S and a molecular weight of 583.07 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[4-[(2,5-dimethylphenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-5-[4-[(2,5-dimethylphenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139996632 |
| Molecular Formula | C28H27ClN4O6S |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[4-[(2,5-dimethylphenyl)methoxy]phenyl]sulfonyl-N-hydroxy-3-oxo-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | Cc1ccc(C)c(COc2ccc(S(=O)(=O)N3CCc4[nH]n(-c5cccc(Cl)c5)c(=O)c4C3C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C28H27ClN4O6S/c1-17-6-7-18(2)19(14-17)16-39-22-8-10-23(11-9-22)40(37,38)32-13-12-24-25(26(32)27(34)31-36)28(35)33(30-24)21-5-3-4-20(29)15-21/h3-11,14-15,26,30,36H,12-13,16H2,1-2H3,(H,31,34) |
| InChIKey | NJVAKNSXDCLRRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|