C24H33N3O6S — CID 70006432
amino (2R,4S)-4-(butylaminomethyl)-4-hydroxy-1-(4-phenylmethoxyphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 70006432) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is amino (2R,4S)-4-(butylaminomethyl)-4-hydroxy-1-(4-phenylmethoxyphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | amino (2R,4S)-4-(butylaminomethyl)-4-hydroxy-1-(4-phenylmethoxyphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 70006432 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | amino (2R,4S)-4-(butylaminomethyl)-4-hydroxy-1-(4-phenylmethoxyphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCCCNC[C@]1(O)CCN(S(=O)(=O)c2ccc(OCc3ccccc3)cc2)[C@@H](C(=O)ON)C1 |
| InChI | InChI=1S/C24H33N3O6S/c1-2-3-14-26-18-24(29)13-15-27(22(16-24)23(28)33-25)34(30,31)21-11-9-20(10-12-21)32-17-19-7-5-4-6-8-19/h4-12,22,26,29H,2-3,13-18,25H2,1H3/t22-,24+/m1/s1 |
| InChIKey | BVWLBRKKTCLOOH-VWNXMTODSA-N |
| XLogP | 1.96 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|