methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate

C10H12N2O4 — CID 115825393

IUPACmethyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(C(=O)c2ccno2)C1
InChIInChI=1S/C10H12N2O4/c1-15-10(14)7-3-5-12(6-7)9(13)8-2-4-11-16-8/h2,4,7H,3,5-6H2,1H3
InChIKeyXHYWVIAINJHXJL-UHFFFAOYSA-N
MW224.22 g/mol
LogP0.31
Rot. Bonds2

About methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate

methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate (PubChem CID 115825393) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate
PubChem CID115825393
Molecular FormulaC10H12N2O4
Molecular Weight224.22 g/mol
Exact Mass224.08
IUPAC Namemethyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(C(=O)c2ccno2)C1
InChIInChI=1S/C10H12N2O4/c1-15-10(14)7-3-5-12(6-7)9(13)8-2-4-11-16-8/h2,4,7H,3,5-6H2,1H3
InChIKeyXHYWVIAINJHXJL-UHFFFAOYSA-N
XLogP0.31
TPSA72.64 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.22
LogP ≤ 50.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate (CID 115825393) is methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate is COC(=O)C1CCN(C(=O)c2ccno2)C1.
What is the InChIKey of methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate?
The InChIKey is XHYWVIAINJHXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-15-10(14)7-3-5-12(6-7)9(13)8-2-4-11-16-8/h2,4,7H,3,5-6H2,1H3.
What are the key properties of methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate?
methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate has a molecular weight of 224.22 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,2-oxazole-5-carbonyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 115825393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).