C14H14N2O2 — CID 51897824
1,2-oxazol-5-yl-[(3R)-3-phenylpyrrolidin-1-yl]methanone (PubChem CID 51897824) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,2-oxazol-5-yl-[(3R)-3-phenylpyrrolidin-1-yl]methanone.
| Compound Name | 1,2-oxazol-5-yl-[(3R)-3-phenylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51897824 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1,2-oxazol-5-yl-[(3R)-3-phenylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccno1)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H14N2O2/c17-14(13-6-8-15-18-13)16-9-7-12(10-16)11-4-2-1-3-5-11/h1-6,8,12H,7,9-10H2/t12-/m0/s1 |
| InChIKey | DPUAWVNPAOZTRN-LBPRGKRZSA-N |
| XLogP | 2.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |