C11H13N5O2 — CID 121164760
1,2-oxazol-5-yl-[4-(triazol-2-yl)piperidin-1-yl]methanone (PubChem CID 121164760) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1,2-oxazol-5-yl-[4-(triazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | 1,2-oxazol-5-yl-[4-(triazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 121164760 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1,2-oxazol-5-yl-[4-(triazol-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccno1)N1CCC(n2nccn2)CC1 |
| InChI | InChI=1S/C11H13N5O2/c17-11(10-1-4-14-18-10)15-7-2-9(3-8-15)16-12-5-6-13-16/h1,4-6,9H,2-3,7-8H2 |
| InChIKey | PGUXPUCOWWQUKU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |