C9H14BrN3O2S — CID 80675450
3-(bromomethyl)-1-(1H-imidazol-5-ylsulfonyl)piperidine (PubChem CID 80675450) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is 3-(bromomethyl)-1-(1H-imidazol-5-ylsulfonyl)piperidine.
| Compound Name | 3-(bromomethyl)-1-(1H-imidazol-5-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 80675450 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 3-(bromomethyl)-1-(1H-imidazol-5-ylsulfonyl)piperidine |
| SMILES | O=S(=O)(c1cnc[nH]1)N1CCCC(CBr)C1 |
| InChI | InChI=1S/C9H14BrN3O2S/c10-4-8-2-1-3-13(6-8)16(14,15)9-5-11-7-12-9/h5,7-8H,1-4,6H2,(H,11,12) |
| InChIKey | CRPDHWWJQYTSCB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|