C28H30N2O4S — CID 40897728
1-(3-acetylphenyl)sulfonyl-N-[(R)-(4-methylphenyl)-phenylmethyl]piperidine-4-carboxamide (PubChem CID 40897728) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-[(R)-(4-methylphenyl)-phenylmethyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-[(R)-(4-methylphenyl)-phenylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40897728 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-[(R)-(4-methylphenyl)-phenylmethyl]piperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)N[C@H](c3ccccc3)c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C28H30N2O4S/c1-20-11-13-23(14-12-20)27(22-7-4-3-5-8-22)29-28(32)24-15-17-30(18-16-24)35(33,34)26-10-6-9-25(19-26)21(2)31/h3-14,19,24,27H,15-18H2,1-2H3,(H,29,32)/t27-/m1/s1 |
| InChIKey | RNINNUIJCOZCAX-HHHXNRCGSA-N |
| XLogP | 4.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |