C25H27N3O3S — CID 43071749
N-[(4-methylphenyl)-phenylmethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 43071749) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[(4-methylphenyl)-phenylmethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-methylphenyl)-phenylmethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43071749 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[(4-methylphenyl)-phenylmethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3O3S/c1-19-9-11-21(12-10-19)24(20-6-3-2-4-7-20)27-25(29)22-13-16-28(17-14-22)32(30,31)23-8-5-15-26-18-23/h2-12,15,18,22,24H,13-14,16-17H2,1H3,(H,27,29) |
| InChIKey | VQUITJCFAARHFO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |