C14H15ClFNO4S — CID 166273188
(3aR,6aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 166273188) has the molecular formula C14H15ClFNO4S and a molecular weight of 347.80 g/mol. Its IUPAC name is (3aR,6aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 166273188 |
| Molecular Formula | C14H15ClFNO4S |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (3aR,6aS)-2-(4-chloro-2-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H]2CN(S(=O)(=O)c3ccc(Cl)cc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C14H15ClFNO4S/c15-11-1-2-13(12(16)5-11)22(20,21)17-6-9-3-8(14(18)19)4-10(9)7-17/h1-2,5,8-10H,3-4,6-7H2,(H,18,19)/t8?,9-,10+ |
| InChIKey | BOSBAAXSCQAKLW-PBINXNQUSA-N |
| XLogP | 2.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |