C13H17F2NO3S — CID 97239680
(1S)-1-[(3S)-1-(3,5-difluorophenyl)sulfonylpiperidin-3-yl]ethanol (PubChem CID 97239680) has the molecular formula C13H17F2NO3S and a molecular weight of 305.35 g/mol. Its IUPAC name is (1S)-1-[(3S)-1-(3,5-difluorophenyl)sulfonylpiperidin-3-yl]ethanol.
| Compound Name | (1S)-1-[(3S)-1-(3,5-difluorophenyl)sulfonylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 97239680 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (1S)-1-[(3S)-1-(3,5-difluorophenyl)sulfonylpiperidin-3-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1CCCN(S(=O)(=O)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C13H17F2NO3S/c1-9(17)10-3-2-4-16(8-10)20(18,19)13-6-11(14)5-12(15)7-13/h5-7,9-10,17H,2-4,8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | AGEVPSSSWXEJFS-UWVGGRQHSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |