C7H15N3O3S — CID 103657393
N-methyl-1-sulfamoylpiperidine-3-carboxamide (PubChem CID 103657393) has the molecular formula C7H15N3O3S and a molecular weight of 221.28 g/mol. Its IUPAC name is N-methyl-1-sulfamoylpiperidine-3-carboxamide.
| Compound Name | N-methyl-1-sulfamoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103657393 |
| Molecular Formula | C7H15N3O3S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N-methyl-1-sulfamoylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C7H15N3O3S/c1-9-7(11)6-3-2-4-10(5-6)14(8,12)13/h6H,2-5H2,1H3,(H,9,11)(H2,8,12,13) |
| InChIKey | VJLBSNLWOKDBLR-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |