About CID 88930738
CID 88930738 (PubChem CID 88930738) has the molecular formula C6H11BN2O
and a molecular weight of 137.98 g/mol.
Molecular Properties
| Compound Name | CID 88930738 |
| PubChem CID | 88930738 |
| Molecular Formula | C6H11BN2O |
| Molecular Weight | 137.98 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | — |
| SMILES | [B]N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C6H11BN2O/c7-9-3-1-2-5(4-9)6(8)10/h5H,1-4H2,(H2,8,10) |
| InChIKey | GCHAJTZDOMOORN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.98 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88930738 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88930738?
The IUPAC name of CID 88930738 (CID 88930738) is not available.
What is the SMILES notation for CID 88930738?
The canonical SMILES for CID 88930738 is [B]N1CCCC(C(N)=O)C1.
What is the InChIKey of CID 88930738?
The InChIKey is GCHAJTZDOMOORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BN2O/c7-9-3-1-2-5(4-9)6(8)10/h5H,1-4H2,(H2,8,10).
What are the key properties of CID 88930738?
CID 88930738 has a molecular weight of 137.98 g/mol, XLogP of -0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88930738 is sourced from PubChem (CID 88930738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).