C9H16N2O2S — CID 107019311
1-(2-sulfanylpropanoyl)piperidine-3-carboxamide (PubChem CID 107019311) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-(2-sulfanylpropanoyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-sulfanylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 107019311 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2-sulfanylpropanoyl)piperidine-3-carboxamide |
| SMILES | CC(S)C(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C9H16N2O2S/c1-6(14)9(13)11-4-2-3-7(5-11)8(10)12/h6-7,14H,2-5H2,1H3,(H2,10,12) |
| InChIKey | VBPINDRPKOGGNI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|