C15H24F3N3O2 — CID 56811023
1-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]piperidine-3-carboxamide (PubChem CID 56811023) has the molecular formula C15H24F3N3O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56811023 |
| Molecular Formula | C15H24F3N3O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[2-[3-(trifluoromethyl)piperidin-1-yl]propanoyl]piperidine-3-carboxamide |
| SMILES | CC(C(=O)N1CCCC(C(N)=O)C1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H24F3N3O2/c1-10(20-6-3-5-12(9-20)15(16,17)18)14(23)21-7-2-4-11(8-21)13(19)22/h10-12H,2-9H2,1H3,(H2,19,22) |
| InChIKey | LFEOWARUXORBBZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |