C20H25FN2O2S — CID 113076048
1-(2-ethyl-6-methylphenyl)-4-(4-fluoro-2-methylphenyl)sulfonylpiperazine (PubChem CID 113076048) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylphenyl)-4-(4-fluoro-2-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-ethyl-6-methylphenyl)-4-(4-fluoro-2-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113076048 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-(2-ethyl-6-methylphenyl)-4-(4-fluoro-2-methylphenyl)sulfonylpiperazine |
| SMILES | CCc1cccc(C)c1N1CCN(S(=O)(=O)c2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C20H25FN2O2S/c1-4-17-7-5-6-15(2)20(17)22-10-12-23(13-11-22)26(24,25)19-9-8-18(21)14-16(19)3/h5-9,14H,4,10-13H2,1-3H3 |
| InChIKey | HGGWYRUKQWQAER-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |