C18H21FN2O2S — CID 5012297
1-(2,6-dimethylphenyl)-4-(2-fluorophenyl)sulfonylpiperazine (PubChem CID 5012297) has the molecular formula C18H21FN2O2S and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-4-(2-fluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2,6-dimethylphenyl)-4-(2-fluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 5012297 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-4-(2-fluorophenyl)sulfonylpiperazine |
| SMILES | Cc1cccc(C)c1N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H21FN2O2S/c1-14-6-5-7-15(2)18(14)20-10-12-21(13-11-20)24(22,23)17-9-4-3-8-16(17)19/h3-9H,10-13H2,1-2H3 |
| InChIKey | IBJHEUNLSJBTHI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |