C17H19FN2O3S — CID 3799087
1-(2-fluorophenyl)sulfonyl-4-(3-methoxyphenyl)piperazine (PubChem CID 3799087) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-4-(3-methoxyphenyl)piperazine.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-4-(3-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3799087 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-4-(3-methoxyphenyl)piperazine |
| SMILES | COc1cccc(N2CCN(S(=O)(=O)c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C17H19FN2O3S/c1-23-15-6-4-5-14(13-15)19-9-11-20(12-10-19)24(21,22)17-8-3-2-7-16(17)18/h2-8,13H,9-12H2,1H3 |
| InChIKey | SCEJCAPUTNCIKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |