C23H24N4O5 — CID 55944106
2-[(2S)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione (PubChem CID 55944106) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[(2S)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 55944106 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[(2S)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)[C@H](C)N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)CC2)c1C |
| InChI | InChI=1S/C23H24N4O5/c1-14-6-4-8-18(15(14)2)24-10-12-25(13-11-24)21(28)16(3)26-22(29)17-7-5-9-19(27(31)32)20(17)23(26)30/h4-9,16H,10-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | FJVUUWALMKWYDL-INIZCTEOSA-N |
| XLogP | 2.54 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|