C23H22N4O7S — CID 55341619
4-nitro-2-[1-oxo-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-2-yl]isoindole-1,3-dione (PubChem CID 55341619) has the molecular formula C23H22N4O7S and a molecular weight of 498.52 g/mol. Its IUPAC name is 4-nitro-2-[1-oxo-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[1-oxo-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55341619 |
| Molecular Formula | C23H22N4O7S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-nitro-2-[1-oxo-1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]propan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C23H22N4O7S/c1-16(26-22(29)18-8-5-9-19(27(31)32)20(18)23(26)30)21(28)24-11-13-25(14-12-24)35(33,34)15-10-17-6-3-2-4-7-17/h2-10,15-16H,11-14H2,1H3/b15-10+ |
| InChIKey | AXMDZDDKWVTHCH-XNTDXEJSSA-N |
| XLogP | 1.72 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|