C16H21FN4O4S — CID 45351245
1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]propanoyl]imidazolidin-2-one (PubChem CID 45351245) has the molecular formula C16H21FN4O4S and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]propanoyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 45351245 |
| Molecular Formula | C16H21FN4O4S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]propanoyl]imidazolidin-2-one |
| SMILES | CC(C(=O)N1CCNC1=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H21FN4O4S/c1-12(15(22)21-6-5-18-16(21)23)19-7-9-20(10-8-19)26(24,25)14-4-2-3-13(17)11-14/h2-4,11-12H,5-10H2,1H3,(H,18,23) |
| InChIKey | GTKZQRGWFXNOEY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |