C26H29N3O6 — CID 55590484
2-[1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 55590484) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-[1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55590484 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-[1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C26H29N3O6/c1-16(2)22(29-24(31)20-7-5-6-8-21(20)25(29)32)26(33)28-11-9-27(10-12-28)23(30)17-13-18(34-3)15-19(14-17)35-4/h5-8,13-16,22H,9-12H2,1-4H3 |
| InChIKey | DTFXYHSMXOMRME-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|