C20H27N3O3 — CID 120820348
2-[1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 120820348) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 120820348 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-[1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C(C(=O)N1CCC(N)C(C)(C)C1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27N3O3/c1-12(2)16(19(26)22-10-9-15(21)20(3,4)11-22)23-17(24)13-7-5-6-8-14(13)18(23)25/h5-8,12,15-16H,9-11,21H2,1-4H3 |
| InChIKey | LHAVJLFKNBAZTJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|