C34H24N6O10 — CID 100997683
5-nitro-2-[2-[N-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethyl]isoindole-1,3-dione (PubChem CID 100997683) has the molecular formula C34H24N6O10 and a molecular weight of 676.60 g/mol. Its IUPAC name is 5-nitro-2-[2-[N-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[2-[N-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 100997683 |
| Molecular Formula | C34H24N6O10 |
| Molecular Weight | 676.60 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 5-nitro-2-[2-[N-[2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCN(CCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)c1ccc(/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C34H24N6O10/c41-31-27-13-11-25(39(47)48)19-29(27)33(43)36(31)17-15-35(16-18-37-32(42)28-14-12-26(40(49)50)20-30(28)34(37)44)23-7-3-21(4-8-23)1-2-22-5-9-24(10-6-22)38(45)46/h1-14,19-20H,15-18H2/b2-1+ |
| InChIKey | DRLMHDWSEAYAOG-OWOJBTEDSA-N |
| XLogP | 4.98 |
| TPSA | 207.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|