C34H26N4O8 — CID 100995712
5-[2-[N-[2-(1,3-dioxoisoindol-5-yl)oxyethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethoxy]isoindole-1,3-dione (PubChem CID 100995712) has the molecular formula C34H26N4O8 and a molecular weight of 618.60 g/mol. Its IUPAC name is 5-[2-[N-[2-(1,3-dioxoisoindol-5-yl)oxyethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethoxy]isoindole-1,3-dione.
| Compound Name | 5-[2-[N-[2-(1,3-dioxoisoindol-5-yl)oxyethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 100995712 |
| Molecular Formula | C34H26N4O8 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 5-[2-[N-[2-(1,3-dioxoisoindol-5-yl)oxyethyl]-4-[(E)-2-(4-nitrophenyl)ethenyl]anilino]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(OCCN(CCOc3ccc4c(c3)C(=O)NC4=O)c3ccc(/C=C/c4ccc([N+](=O)[O-])cc4)cc3)ccc21 |
| InChI | InChI=1S/C34H26N4O8/c39-31-27-13-11-25(19-29(27)33(41)35-31)45-17-15-37(16-18-46-26-12-14-28-30(20-26)34(42)36-32(28)40)23-7-3-21(4-8-23)1-2-22-5-9-24(10-6-22)38(43)44/h1-14,19-20H,15-18H2,(H,35,39,41)(H,36,40,42)/b2-1+ |
| InChIKey | OJDHKPBYEPMXKI-OWOJBTEDSA-N |
| XLogP | 4.50 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|