C18H28N2O3 — CID 75394752
1-[4-(furan-2-ylmethyl)piperazin-1-yl]nonane-1,8-dione (PubChem CID 75394752) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-[4-(furan-2-ylmethyl)piperazin-1-yl]nonane-1,8-dione.
| Compound Name | 1-[4-(furan-2-ylmethyl)piperazin-1-yl]nonane-1,8-dione |
|---|---|
| PubChem CID | 75394752 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-[4-(furan-2-ylmethyl)piperazin-1-yl]nonane-1,8-dione |
| SMILES | CC(=O)CCCCCCC(=O)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C18H28N2O3/c1-16(21)7-4-2-3-5-9-18(22)20-12-10-19(11-13-20)15-17-8-6-14-23-17/h6,8,14H,2-5,7,9-13,15H2,1H3 |
| InChIKey | JSRLVBKVHDBNBI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|