C20H27N4O4+ — CID 9021784
2-[4-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide (PubChem CID 9021784) has the molecular formula C20H27N4O4+ and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9021784 |
| Molecular Formula | C20H27N4O4+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[NH+]1CCN(C(=O)CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C20H26N4O4/c1-21(2)18(26)14-22-10-12-23(13-11-22)17(25)8-5-9-24-19(27)15-6-3-4-7-16(15)20(24)28/h3-4,6-7H,5,8-14H2,1-2H3/p+1 |
| InChIKey | GFCWPNAZWHAZQV-UHFFFAOYSA-O |
| XLogP | -1.12 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|