C23H17NO4S — CID 2307091
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-10,10-dioxothioxanthen-9-one (PubChem CID 2307091) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-10,10-dioxothioxanthen-9-one.
| Compound Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 2307091 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-10,10-dioxothioxanthen-9-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2cc(C(=O)N3CCCc4ccccc43)ccc21 |
| InChI | InChI=1S/C23H17NO4S/c25-22-17-8-2-4-10-20(17)29(27,28)21-14-16(11-12-18(21)22)23(26)24-13-5-7-15-6-1-3-9-19(15)24/h1-4,6,8-12,14H,5,7,13H2 |
| InChIKey | UZFFXSQHHDWYJK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |