C22H14O6S — CID 8840182
(3-acetylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 8840182) has the molecular formula C22H14O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is (3-acetylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | (3-acetylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 8840182 |
| Molecular Formula | C22H14O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (3-acetylphenyl) 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | CC(=O)c1cccc(OC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C22H14O6S/c1-13(23)14-5-4-6-16(11-14)28-22(25)15-9-10-18-20(12-15)29(26,27)19-8-3-2-7-17(19)21(18)24/h2-12H,1H3 |
| InChIKey | YFNZVDKLNZREHB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|